Products 87694-58-4
CAS 87694-58-4 appears in our catalog under these names: Pyr-Trp-OEt, Glp-Trp-OEt. Offered by: Biosynth, MedChemExpress. Available pack sizes: 500mg, 1000mg, 2000mg, Get quote.
Ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoate (CAS 87694-58-4) is a chemical compound with the molecular formula C18H21N3O4 and a molecular weight of 343.4 g/mol. IUPAC name: ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoate. InChIKey: JFOQWEKVEWTJOQ-GJZGRUSLSA-N.
| Molecular formula | C18H21N3O4 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoate |
| InChIKey | JFOQWEKVEWTJOQ-GJZGRUSLSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CNC2=CC=CC=C21)NC(=O)[C@@H]3CCC(=O)N3 |
Computed by PubChem (NCBI)