CAS 195964-65-9 appears in our catalog under these names: 1-(tert-Butyl) 2-methyl (2S)-5-allylpyrrolidine-1,2-dicarboxylate, 98%, 1–(Tert–butyl) 2–methyl (2S)–5–allylpyrrolidine–1,2–dicarboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate (CAS 195964-65-9) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate. InChIKey: VGDATZBYQWJPSE-DTIOYNMSSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| InChIKey | VGDATZBYQWJPSE-DTIOYNMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCC1CC=C)C(=O)OC |
Computed by PubChem (NCBI)