CAS 1962-10-3 is the registry number for 3,4,6-Trichlorobenzene-1,2-diamine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,4,6-trichlorobenzene-1,2-diamine (CAS 1962-10-3) is a chemical compound with the molecular formula C6H5Cl3N2 and a molecular weight of 211.5 g/mol. IUPAC name: 3,4,6-trichlorobenzene-1,2-diamine. InChIKey: XZASMRJDZQLRMV-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2 |
|---|---|
| Molecular weight | 211.5 g/mol |
| IUPAC name | 3,4,6-trichlorobenzene-1,2-diamine |
| InChIKey | XZASMRJDZQLRMV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)N)N)Cl |
Computed by PubChem (NCBI)