CAS 6585-48-4 is the registry number for 2,4,5-Trichloro-6-ethylpyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2,4,5-trichloro-6-ethylpyrimidine (CAS 6585-48-4) is a chemical compound with the molecular formula C6H5Cl3N2 and a molecular weight of 211.5 g/mol. IUPAC name: 2,4,5-trichloro-6-ethylpyrimidine. InChIKey: PAMHFOVFWWAYCK-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2 |
|---|---|
| Molecular weight | 211.5 g/mol |
| IUPAC name | 2,4,5-trichloro-6-ethylpyrimidine |
| InChIKey | PAMHFOVFWWAYCK-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NC(=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)