CAS 196316-30-0 is the registry number for Stereoisomer-4,16-Dibromo[2.2]paracyclophane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,11-dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (CAS 196316-30-0) is a chemical compound with the molecular formula C16H14Br2 and a molecular weight of 366.09 g/mol. IUPAC name: 5,11-dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene. InChIKey: QDMAXRJHDMKTQH-UHFFFAOYSA-N.
| Molecular formula | C16H14Br2 |
|---|---|
| Molecular weight | 366.09 g/mol |
| IUPAC name | 5,11-dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| InChIKey | QDMAXRJHDMKTQH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(CCC3=C(C=C1C=C3)Br)C=C2)Br |
Computed by PubChem (NCBI)