CAS 23927-42-6 appears in our catalog under these names: Pseudo–meta–Dibromo(2·2)paracyclophane, pseudo-meta-5,12-Dibromotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene 95%, 5,12-Dibromotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
5,12-dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (CAS 23927-42-6) is a chemical compound with the molecular formula C16H14Br2 and a molecular weight of 366.09 g/mol. IUPAC name: 5,12-dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene. InChIKey: YTVHCBMSDDDSSN-UHFFFAOYSA-N.
| Molecular formula | C16H14Br2 |
|---|---|
| Molecular weight | 366.09 g/mol |
| IUPAC name | 5,12-dibromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| InChIKey | YTVHCBMSDDDSSN-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=C(C=C1C=C3)Br)C=C2)Br |
Computed by PubChem (NCBI)