Products 1963615-39-5

CAS 1963615-39-5 is the registry number for 3-(3,4-Dibromophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,4-dibromophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1963615-39-5) is a chemical compound with the molecular formula C11H7Br2NO3 and a molecular weight of 360.99 g/mol. IUPAC name: 3-(3,4-dibromophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: RYMDEOQWQSLYFV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7Br2NO3
Molecular weight360.99 g/mol
IUPAC name3-(3,4-dibromophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyRYMDEOQWQSLYFV-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC(=C(C=C2)Br)Br)C(=O)O

Computed by PubChem (NCBI)