CAS 2092001-14-2 is the registry number for 1,6-Dibromo-2-methoxy-3-nitronaphthalene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
1,6-dibromo-2-methoxy-3-nitronaphthalene (CAS 2092001-14-2) is a chemical compound with the molecular formula C11H7Br2NO3 and a molecular weight of 360.99 g/mol. IUPAC name: 1,6-dibromo-2-methoxy-3-nitronaphthalene. InChIKey: LXJTVDQLLYQPBR-UHFFFAOYSA-N.
| Molecular formula | C11H7Br2NO3 |
|---|---|
| Molecular weight | 360.99 g/mol |
| IUPAC name | 1,6-dibromo-2-methoxy-3-nitronaphthalene |
| InChIKey | LXJTVDQLLYQPBR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(C=CC2=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)