CAS 1964475-99-7 is the registry number for tert-Butyl 4-(5-bromothiophen-2-yl)piperazine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-(5-bromothiophen-2-yl)piperazine-1-carboxylate (CAS 1964475-99-7) is a chemical compound with the molecular formula C13H19BrN2O2S and a molecular weight of 347.27 g/mol. IUPAC name: tert-butyl 4-(5-bromothiophen-2-yl)piperazine-1-carboxylate. InChIKey: GRLHKHODUDAOEB-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O2S |
|---|---|
| Molecular weight | 347.27 g/mol |
| IUPAC name | tert-butyl 4-(5-bromothiophen-2-yl)piperazine-1-carboxylate |
| InChIKey | GRLHKHODUDAOEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)