CAS 2138097-50-2 appears in our catalog under these names: tert-Butyl 4-(2-bromothiazol-4-yl)piperidine-1-carboxylate, 98%, tert-Butyl 4-(2-bromo-1,3-thiazol-4-yl)piperidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
Tert-butyl 4-(2-bromo-1,3-thiazol-4-yl)piperidine-1-carboxylate (CAS 2138097-50-2) is a chemical compound with the molecular formula C13H19BrN2O2S and a molecular weight of 347.27 g/mol. IUPAC name: tert-butyl 4-(2-bromo-1,3-thiazol-4-yl)piperidine-1-carboxylate. InChIKey: FJHVNEZFABTJLT-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O2S |
|---|---|
| Molecular weight | 347.27 g/mol |
| IUPAC name | tert-butyl 4-(2-bromo-1,3-thiazol-4-yl)piperidine-1-carboxylate |
| InChIKey | FJHVNEZFABTJLT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CSC(=N2)Br |
Computed by PubChem (NCBI)