CAS 19645-79-5 is the registry number for beta,2-Dihydroxybenzenepropanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
3-hydroxy-3-(2-hydroxyphenyl)propanoic acid (CAS 19645-79-5) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 3-hydroxy-3-(2-hydroxyphenyl)propanoic acid. InChIKey: NPHUVMKODADFLN-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 3-hydroxy-3-(2-hydroxyphenyl)propanoic acid |
| InChIKey | NPHUVMKODADFLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CC(=O)O)O)O |
Computed by PubChem (NCBI)