CAS 19647-71-3 appears in our catalog under these names: Z-Phe-pna, 95%, Z–Phe–pNA, Z-L-Phe-pNA. Offered by: Combi-blocks, GLPBio, Iris Biotech. Available pack sizes: 10g, 1g, 5g, 25g.
Benzyl N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 19647-71-3) is a chemical compound with the molecular formula C23H21N3O5 and a molecular weight of 419.4 g/mol. IUPAC name: benzyl N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: JZPHGMKKKDRFSU-NRFANRHFSA-N.
| Molecular formula | C23H21N3O5 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | JZPHGMKKKDRFSU-NRFANRHFSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)