Products 2313528-04-8
CAS 2313528-04-8 appears in our catalog under these names: hnRNPK–IN–1, hnRNPK-IN-1, 97.0%, 97.0%, hnRNPK-IN-1, 97.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 25 mg, 10 mg.
(E)-1-(4-methoxyphenyl)-3-(4-morpholin-4-yl-6-nitroquinolin-2-yl)prop-2-en-1-one (CAS 2313528-04-8) is a chemical compound with the molecular formula C23H21N3O5 and a molecular weight of 419.4 g/mol. IUPAC name: (E)-1-(4-methoxyphenyl)-3-(4-morpholin-4-yl-6-nitroquinolin-2-yl)prop-2-en-1-one. InChIKey: PFTIJUIEMIEMQH-RUDMXATFSA-N.
| Molecular formula | C23H21N3O5 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (E)-1-(4-methoxyphenyl)-3-(4-morpholin-4-yl-6-nitroquinolin-2-yl)prop-2-en-1-one |
| InChIKey | PFTIJUIEMIEMQH-RUDMXATFSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)/C=C/C2=CC(=C3C=C(C=CC3=N2)[N+](=O)[O-])N4CCOCC4 |
Computed by PubChem (NCBI)