CAS 196517-43-8 is the registry number for ER-38925. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid (CAS 196517-43-8) is a chemical compound with the molecular formula C21H17NO3 and a molecular weight of 331.4 g/mol. IUPAC name: 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid. InChIKey: LSZNZLWBRQAWNH-UHFFFAOYSA-N.
| Molecular formula | C21H17NO3 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| InChIKey | LSZNZLWBRQAWNH-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(OC2=C(C=C1)C)C3=CC=C(N3)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)