CAS 56632-39-4 appears in our catalog under these names: BHPI, BHPI 98+%, 3,3-Bis(4-hydroxyphenyl)-7-methylindolin-2-one, 98+%, 98+%, BHPI, 98.0%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25mg, 10mg, 10mM (in 1ml dmso), 2mg, 5mg, 50mg, 100mg, 250mg.
3,3-bis(4-hydroxyphenyl)-7-methyl-1H-indol-2-one (CAS 56632-39-4) is a chemical compound with the molecular formula C21H17NO3 and a molecular weight of 331.4 g/mol. IUPAC name: 3,3-bis(4-hydroxyphenyl)-7-methyl-1H-indol-2-one. InChIKey: FABLAHMQSQFDHR-UHFFFAOYSA-N.
| Molecular formula | C21H17NO3 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 3,3-bis(4-hydroxyphenyl)-7-methyl-1H-indol-2-one |
| InChIKey | FABLAHMQSQFDHR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(C(=O)N2)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)