CAS 1965290-13-4 is the registry number for Rac-(1s,6r)-3,9-diazabicyclo[4.2.1]nonan-4-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-4-one;dihydrochloride (CAS 1965290-13-4) is a chemical compound with the molecular formula C7H14Cl2N2O and a molecular weight of 213.10 g/mol. IUPAC name: (1S,6R)-3,9-diazabicyclo[4.2.1]nonan-4-one;dihydrochloride. InChIKey: XLHCYBARFYUSEY-PVNUIUKASA-N.
| Molecular formula | C7H14Cl2N2O |
|---|---|
| Molecular weight | 213.10 g/mol |
| IUPAC name | (1S,6R)-3,9-diazabicyclo[4.2.1]nonan-4-one;dihydrochloride |
| InChIKey | XLHCYBARFYUSEY-PVNUIUKASA-N |
| SMILES | C1C[C@H]2CNC(=O)C[C@@H]1N2.Cl.Cl |
Computed by PubChem (NCBI)