CAS 2708280-41-3 appears in our catalog under these names: 1-(2,6-Diazaspiro(3.3)heptan-2-yl)ethan-1-one dihydrochloride, 98%, 1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone;dihydrochloride (CAS 2708280-41-3) is a chemical compound with the molecular formula C7H14Cl2N2O and a molecular weight of 213.10 g/mol. IUPAC name: 1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone;dihydrochloride. InChIKey: UGEMJBDVONXADW-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N2O |
|---|---|
| Molecular weight | 213.10 g/mol |
| IUPAC name | 1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone;dihydrochloride |
| InChIKey | UGEMJBDVONXADW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2(C1)CNC2.Cl.Cl |
Computed by PubChem (NCBI)