CAS 1965304-61-3 appears in our catalog under these names: tert-Butyl [2-(4-amino-1h-pyrazol-1-yl)ethyl]carbamate oxalate, 95%, tert–Butyl (2–(4–amino–1H–pyrazol–1–yl)ethyl)carbamate oxalate, tert-Butyl [2-(4-amino-1h-pyrazol-1-yl)ethyl]carbamate oxalate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Tert-butyl N-[2-(4-aminopyrazol-1-yl)ethyl]carbamate;oxalic acid (CAS 1965304-61-3) is a chemical compound with the molecular formula C12H20N4O6 and a molecular weight of 316.31 g/mol. IUPAC name: tert-butyl N-[2-(4-aminopyrazol-1-yl)ethyl]carbamate;oxalic acid. InChIKey: VQOTXRDCJXLTAE-UHFFFAOYSA-N.
| Molecular formula | C12H20N4O6 |
|---|---|
| Molecular weight | 316.31 g/mol |
| IUPAC name | tert-butyl N-[2-(4-aminopyrazol-1-yl)ethyl]carbamate;oxalic acid |
| InChIKey | VQOTXRDCJXLTAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCN1C=C(C=N1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)