CAS 69624-04-0 appears in our catalog under these names: Ac–Gln–Gln–OH, Ac-Gln-Gln-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
(2S)-2-[[(2S)-2-acetamido-5-amino-5-oxopentanoyl]amino]-5-amino-5-oxopentanoic acid (CAS 69624-04-0) is a chemical compound with the molecular formula C12H20N4O6 and a molecular weight of 316.31 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-5-amino-5-oxopentanoyl]amino]-5-amino-5-oxopentanoic acid. InChIKey: KKQQDQHEOLWKFV-YUMQZZPRSA-N.
| Molecular formula | C12H20N4O6 |
|---|---|
| Molecular weight | 316.31 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-5-amino-5-oxopentanoyl]amino]-5-amino-5-oxopentanoic acid |
| InChIKey | KKQQDQHEOLWKFV-YUMQZZPRSA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)