CAS 1965309-82-3 is the registry number for 4-Methoxy-1H-indol-6-ylaminehydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
4-methoxy-1H-indol-6-amine;hydrochloride (CAS 1965309-82-3) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 4-methoxy-1H-indol-6-amine;hydrochloride. InChIKey: HTOJITWGIOWMJY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 4-methoxy-1H-indol-6-amine;hydrochloride |
| InChIKey | HTOJITWGIOWMJY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C=CN2)N.Cl |
Computed by PubChem (NCBI)