CAS 1965556-14-2 is the registry number for α-Cyclopropyl-4-fluoro-α-methyl-3-(trifluoromethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol (CAS 1965556-14-2) is a chemical compound with the molecular formula C12H12F4O and a molecular weight of 248.22 g/mol. IUPAC name: 1-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol. InChIKey: DGLIDZUWXMRTLG-UHFFFAOYSA-N.
| Molecular formula | C12H12F4O |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 1-cyclopropyl-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethanol |
| InChIKey | DGLIDZUWXMRTLG-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)(C2=CC(=C(C=C2)F)C(F)(F)F)O |
Computed by PubChem (NCBI)