CAS 343305-41-9 appears in our catalog under these names: 4-(tert-Butoxy)-2,3,5,6-tetrafluorostyrene, 95%, 4-(tert-Butoxy)-2,3,5,6-tetrafluorostyrene, mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
1-ethenyl-2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]benzene (CAS 343305-41-9) is a chemical compound with the molecular formula C12H12F4O and a molecular weight of 248.22 g/mol. IUPAC name: 1-ethenyl-2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: QRKPOBGCHDVVRQ-UHFFFAOYSA-N.
| Molecular formula | C12H12F4O |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 1-ethenyl-2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | QRKPOBGCHDVVRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C(=C(C(=C1F)F)C=C)F)F |
Computed by PubChem (NCBI)