CAS 196597-61-2 appears in our catalog under these names: Ramelteon Impurity 23, (E)-2-(1,6,7,8-Tetrahydro-2H-indeno(5,4-b)furan-8-ylidene)ethylamine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2E)-2-(1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)ethanamine (CAS 196597-61-2) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: (2E)-2-(1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)ethanamine. InChIKey: RYYNBBSULBXPJL-BJMVGYQFSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | (2E)-2-(1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)ethanamine |
| InChIKey | RYYNBBSULBXPJL-BJMVGYQFSA-N |
| SMILES | C1C/C(=C\CN)/C2=C1C=CC3=C2CCO3 |
Computed by PubChem (NCBI)