CAS 196714-44-0 is the registry number for (2R,3R,4R,5R,6S)-5-Acetamido-2-(acetoxymethyl)-6-azidotetrahydro-2H-pyran-3,4-diyl Diacetate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-azidooxan-2-yl]methyl acetate (CAS 196714-44-0) is a chemical compound with the molecular formula C14H20N4O8 and a molecular weight of 372.33 g/mol. IUPAC name: [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-azidooxan-2-yl]methyl acetate. InChIKey: RMCFMPMNMQZHSF-RGDJUOJXSA-N.
| Molecular formula | C14H20N4O8 |
|---|---|
| Molecular weight | 372.33 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-azidooxan-2-yl]methyl acetate |
| InChIKey | RMCFMPMNMQZHSF-RGDJUOJXSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@@H]1N=[N+]=[N-])COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)