CAS 196791-00-1 appears in our catalog under these names: FA-Asp-Ala-OH, FA–Asp–Ala–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 250mg, 50mg, 100mg, 500mg.
(3S)-4-[[(1S)-1-carboxyethyl]amino]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-oxobutanoic acid (CAS 196791-00-1) is a chemical compound with the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. IUPAC name: (3S)-4-[[(1S)-1-carboxyethyl]amino]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-oxobutanoic acid. InChIKey: RVYAXJAXQULNIF-AGCSXLRFSA-N.
| Molecular formula | C14H16N2O7 |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | (3S)-4-[[(1S)-1-carboxyethyl]amino]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4-oxobutanoic acid |
| InChIKey | RVYAXJAXQULNIF-AGCSXLRFSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)