Products 356526-76-6

CAS 356526-76-6 is the registry number for 4-Oxo-4-(2-(3,4,5-trimethoxybenzoyl)hydrazinyl)but-2-enoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-4-oxo-4-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]but-2-enoic acid (CAS 356526-76-6) is a chemical compound with the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. IUPAC name: (E)-4-oxo-4-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]but-2-enoic acid. InChIKey: FLJPCVIXFARWJL-SNAWJCMRSA-N.

Identity
Molecular formulaC14H16N2O7
Molecular weight324.29 g/mol
IUPAC name(E)-4-oxo-4-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]but-2-enoic acid
InChIKeyFLJPCVIXFARWJL-SNAWJCMRSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(=O)NNC(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)