CAS 196953-12-5 appears in our catalog under these names: 1-(1-Naphthalenyl)-2,3-butadien-1-one, 95%, 95%, 1-(1-Naphthalenyl)-2,3-butadien-1-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-naphthalen-1-ylbuta-2,3-dien-1-one (CAS 196953-12-5) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 1-naphthalen-1-ylbuta-2,3-dien-1-one. InChIKey: RVDMGRMFACGYKH-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-naphthalen-1-ylbuta-2,3-dien-1-one |
| InChIKey | RVDMGRMFACGYKH-UHFFFAOYSA-N |
| SMILES | C=C=CC(=O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)