CAS 19701-84-9 appears in our catalog under these names: Ac-Val-NHMe, Ac–Val–NHMe. Offered by: Creative Peptides, GLPBio. Available pack sizes: 250mg, 1g.
(2S)-2-acetamido-N,3-dimethylbutanamide (CAS 19701-84-9) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: (2S)-2-acetamido-N,3-dimethylbutanamide. InChIKey: CERMWOUCIZTOBO-ZETCQYMHSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (2S)-2-acetamido-N,3-dimethylbutanamide |
| InChIKey | CERMWOUCIZTOBO-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC)NC(=O)C |
Computed by PubChem (NCBI)