CAS 197015-72-8 appears in our catalog under these names: 1-Iodo-2-methoxy-3,5-bis(trifluoromethyl)benzene, 95%, 1-Iodo-2-methoxy-3,5-bis(trifluoromethyl)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-iodo-2-methoxy-3,5-bis(trifluoromethyl)benzene (CAS 197015-72-8) is a chemical compound with the molecular formula C9H5F6IO and a molecular weight of 370.03 g/mol. IUPAC name: 1-iodo-2-methoxy-3,5-bis(trifluoromethyl)benzene. InChIKey: LKIMZVGUJTYKLF-UHFFFAOYSA-N.
| Molecular formula | C9H5F6IO |
|---|---|
| Molecular weight | 370.03 g/mol |
| IUPAC name | 1-iodo-2-methoxy-3,5-bis(trifluoromethyl)benzene |
| InChIKey | LKIMZVGUJTYKLF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1I)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)