CAS 2270907-14-5 is the registry number for 2-Iodo-1-(2,2,2-trifluoro-ethoxy)-4-trifluoromethyl-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-iodo-1-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)benzene (CAS 2270907-14-5) is a chemical compound with the molecular formula C9H5F6IO and a molecular weight of 370.03 g/mol. IUPAC name: 2-iodo-1-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)benzene. InChIKey: LIQITWPOYDXTAU-UHFFFAOYSA-N.
| Molecular formula | C9H5F6IO |
|---|---|
| Molecular weight | 370.03 g/mol |
| IUPAC name | 2-iodo-1-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)benzene |
| InChIKey | LIQITWPOYDXTAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)I)OCC(F)(F)F |
Computed by PubChem (NCBI)