CAS 1971-81-9 appears in our catalog under these names: 4-(Dimethylamino)-1-naphthaldehyde 95%, 4-(Dimethylamino),-1-naphthaldehyde, 98%, 98%, 4-(Dimethylamino)-1-naphthaldehyde, 90%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-(dimethylamino)naphthalene-1-carbaldehyde (CAS 1971-81-9) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 4-(dimethylamino)naphthalene-1-carbaldehyde. InChIKey: XCQFZIFIUMBSAO-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-(dimethylamino)naphthalene-1-carbaldehyde |
| InChIKey | XCQFZIFIUMBSAO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C2=CC=CC=C21)C=O |
Computed by PubChem (NCBI)