CAS 1971007-90-5 appears in our catalog under these names: MMB–FUBICA, MMB-FUBICA. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg.
Methyl (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3-methylbutanoate (CAS 1971007-90-5) is a chemical compound with the molecular formula C22H23FN2O3 and a molecular weight of 382.4 g/mol. IUPAC name: methyl (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3-methylbutanoate. InChIKey: NYQOGZPXNJSYDW-FQEVSTJZSA-N.
| Molecular formula | C22H23FN2O3 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | methyl (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3-methylbutanoate |
| InChIKey | NYQOGZPXNJSYDW-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)