Products 2693397-46-3
CAS 2693397-46-3 appears in our catalog under these names: MDMB–FUBICA metabolite 3, MDMB-FUBICA metabolite 3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
(2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 2693397-46-3) is a chemical compound with the molecular formula C22H23FN2O3 and a molecular weight of 382.4 g/mol. IUPAC name: (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: PZPKPULZRMBYJZ-LJQANCHMSA-N.
| Molecular formula | C22H23FN2O3 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | PZPKPULZRMBYJZ-LJQANCHMSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)