CAS 1971858-34-0 appears in our catalog under these names: (5-(Trifluoromethyl)thiophen-2-yl)methanamine Hydrochloride, [5-(Trifluoromethyl)thiophen-2-yl]methanamine hydrochloride, 95%, 95%, 1-[5-(TRIFLUOROMETHYL)THIOPHEN-2-YL]METHANAMINE HYDROCHLORIDE, 96%, [5-(Trifluoromethyl)thiophen-2-yl]methanamine hydrochloride, 95%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 750mg, 50mg, 100mg, 250mg, 1g.
[5-(trifluoromethyl)thiophen-2-yl]methanamine;hydrochloride (CAS 1971858-34-0) is a chemical compound with the molecular formula C6H7ClF3NS and a molecular weight of 217.64 g/mol. IUPAC name: [5-(trifluoromethyl)thiophen-2-yl]methanamine;hydrochloride. InChIKey: VVVYILROYJGFRC-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3NS |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | [5-(trifluoromethyl)thiophen-2-yl]methanamine;hydrochloride |
| InChIKey | VVVYILROYJGFRC-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)