CAS 2173999-10-3 is the registry number for (4-(Trifluoromethyl)thiophen-3-yl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[4-(trifluoromethyl)thiophen-3-yl]methanamine;hydrochloride (CAS 2173999-10-3) is a chemical compound with the molecular formula C6H7ClF3NS and a molecular weight of 217.64 g/mol. IUPAC name: [4-(trifluoromethyl)thiophen-3-yl]methanamine;hydrochloride. InChIKey: NGYAFPNWNIFMIB-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3NS |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | [4-(trifluoromethyl)thiophen-3-yl]methanamine;hydrochloride |
| InChIKey | NGYAFPNWNIFMIB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CS1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)