CAS 1972612-60-4 appears in our catalog under these names: Bedaquiline Fumarate Impurity 8, (1S,2S)-1-(6-Bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(naphthalen-1-yl)-1-phenylbutan-2-ol, 98%, 98%, Bedaquinoline impurity 1, 98.63%, Bedaquiline Fumarate Impurity 39. Offered by: Chemat Brand, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 10 mg, 50 mg, 25 mg, 100 mg, 5 mg.
(1S,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol (CAS 1972612-60-4) is a chemical compound with the molecular formula C32H31BrN2O2 and a molecular weight of 555.5 g/mol. IUPAC name: (1S,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol. InChIKey: QUIJNHUBAXPXFS-XDFJSJKPSA-N.
| Molecular formula | C32H31BrN2O2 |
|---|---|
| Molecular weight | 555.5 g/mol |
| IUPAC name | (1S,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
| InChIKey | QUIJNHUBAXPXFS-XDFJSJKPSA-N |
| SMILES | CN(C)CC[C@@](C1=CC=CC2=CC=CC=C21)([C@@H](C3=CC=CC=C3)C4=C(N=C5C=CC(=CC5=C4)Br)OC)O |
Computed by PubChem (NCBI)