Products 654655-80-8
CAS 654655-80-8 appears in our catalog under these names: Bedaquiline (Mixture of Diastereomers), >95% (HPLC), Bedaquiline, (Rac)-Bedaquiline. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 2mg, 1mg, 5mg, 25mg, 10 mg, 1 mg.
1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol (CAS 654655-80-8) is a chemical compound with the molecular formula C32H31BrN2O2 and a molecular weight of 555.5 g/mol. IUPAC name: 1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol. InChIKey: QUIJNHUBAXPXFS-UHFFFAOYSA-N.
| Molecular formula | C32H31BrN2O2 |
|---|---|
| Molecular weight | 555.5 g/mol |
| IUPAC name | 1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
| InChIKey | QUIJNHUBAXPXFS-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(C1=CC=CC2=CC=CC=C21)(C(C3=CC=CC=C3)C4=C(N=C5C=CC(=CC5=C4)Br)OC)O |
Computed by PubChem (NCBI)