CAS 19728-71-3 appears in our catalog under these names: Methyl (S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoate, 98%, Carbidopa Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoate (CAS 19728-71-3) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoate. InChIKey: PICGBRAYRQJNGT-ZDUSSCGKSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoate |
| InChIKey | PICGBRAYRQJNGT-ZDUSSCGKSA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OC)OC)(C(=O)OC)N |
Computed by PubChem (NCBI)