Products 197307-49-6
CAS 197307-49-6 appears in our catalog under these names: 11–Dehydroxygrevilloside B, 11-Dehydroxygrevilloside B. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 2mg, 1mg, 25mg, 10mg, Get quote.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(3-hydroxy-5-pentylphenoxy)oxane-3,4,5-triol (CAS 197307-49-6) is a chemical compound with the molecular formula C17H26O7 and a molecular weight of 342.4 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(3-hydroxy-5-pentylphenoxy)oxane-3,4,5-triol. InChIKey: MWVXDTUYXNKDPO-NQNKBUKLSA-N.
| Molecular formula | C17H26O7 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(3-hydroxy-5-pentylphenoxy)oxane-3,4,5-triol |
| InChIKey | MWVXDTUYXNKDPO-NQNKBUKLSA-N |
| SMILES | CCCCCC1=CC(=CC(=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
Computed by PubChem (NCBI)