CAS 86259-56-5 appears in our catalog under these names: 1–Phenyl–2,5,8,11,14–pentaoxahexadecan–16–oic acid, 1-Phenyl-2,5,8,11,14-pentaoxahexadecan-16-oic acid 95%, 1-Phenyl-2,5,8,11,14-pentaoxahexadecan-16-oic acid, 95%, 95%, BnO-PEG4-CH2COOH, 1-Phenyl-2,5,8,11,14-pentaoxahexadecan-16-oic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g, Get quote.
2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]acetic acid (CAS 86259-56-5) is a chemical compound with the molecular formula C17H26O7 and a molecular weight of 342.4 g/mol. IUPAC name: 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: INZJSUYNTDLKGK-UHFFFAOYSA-N.
| Molecular formula | C17H26O7 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | INZJSUYNTDLKGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)