Products 1973504-60-7
CAS 1973504-60-7 appears in our catalog under these names: NNMT-IN-7, 98.0%, 6-Bromo-2-Methylisoquinolin-2-Ium Iodide, 95%. Offered by: MedChemExpress, Chemat. Available pack sizes: 100 mg, 10mM/1mL, 250 mg, 1 g, 100mg, 250mg, 1g.
6-bromo-2-methylisoquinolin-2-ium iodide (CAS 1973504-60-7) is a chemical compound with the molecular formula C10H9BrIN and a molecular weight of 349.99 g/mol. IUPAC name: 6-bromo-2-methylisoquinolin-2-ium iodide. InChIKey: YBSKKKCVCOLCEX-UHFFFAOYSA-M.
| Molecular formula | C10H9BrIN |
|---|---|
| Molecular weight | 349.99 g/mol |
| IUPAC name | 6-bromo-2-methylisoquinolin-2-ium iodide |
| InChIKey | YBSKKKCVCOLCEX-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC2=C(C=C1)C=C(C=C2)Br.[I-] |
Computed by PubChem (NCBI)