CAS 21979-55-5 appears in our catalog under these names: 3-Bromo-1-methylquinolin-1-ium iodide, 95%, 95%, 3-Bromo-1-methylquinolin-1-ium iodide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-1-methylquinolin-1-ium iodide (CAS 21979-55-5) is a chemical compound with the molecular formula C10H9BrIN and a molecular weight of 349.99 g/mol. IUPAC name: 3-bromo-1-methylquinolin-1-ium iodide. InChIKey: VAFUIIQYULSGHS-UHFFFAOYSA-M.
| Molecular formula | C10H9BrIN |
|---|---|
| Molecular weight | 349.99 g/mol |
| IUPAC name | 3-bromo-1-methylquinolin-1-ium iodide |
| InChIKey | VAFUIIQYULSGHS-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC(=CC2=CC=CC=C21)Br.[I-] |
Computed by PubChem (NCBI)