CAS 1973826-31-1 appears in our catalog under these names: 5-(Pyrimidine-5-carboxamido)isophthalic acid, 95%, 95%, 5-(Pyrimidine-5-carboxamido)isophthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(pyrimidine-5-carbonylamino)benzene-1,3-dicarboxylic acid (CAS 1973826-31-1) is a chemical compound with the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. IUPAC name: 5-(pyrimidine-5-carbonylamino)benzene-1,3-dicarboxylic acid. InChIKey: BTKJRNBTTRZAOH-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O5 |
|---|---|
| Molecular weight | 287.23 g/mol |
| IUPAC name | 5-(pyrimidine-5-carbonylamino)benzene-1,3-dicarboxylic acid |
| InChIKey | BTKJRNBTTRZAOH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)NC(=O)C2=CN=CN=C2)C(=O)O |
Computed by PubChem (NCBI)