CAS 2243-76-7 appears in our catalog under these names: 2-Hydroxy-5-[(E)-2-(4-nitrophenyl)diazen-1-yl]benzoic acid, tech grade, Alizarinyellowrindicator(1·9–3·3,10·1–12·1), Mordant Orange 1, 2-Hydroxy-5-((4-nitrophenyl)diazenyl)benzoic acid, IND, IND, Alizarine Yellow R, 98.0%. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, MedChemExpress. Available pack sizes: 25g, 100g, 5g, 500g, 1000g, 2000g, 10000g, 25000g.
2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid (CAS 2243-76-7) is a chemical compound with the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. IUPAC name: 2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid. InChIKey: YVJPMMYYRNHJAU-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O5 |
|---|---|
| Molecular weight | 287.23 g/mol |
| IUPAC name | 2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid |
| InChIKey | YVJPMMYYRNHJAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC(=C(C=C2)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)