CAS 1975-54-8 appears in our catalog under these names: 5-Cyano-2-methylbenzoic acid, 95%, 5-Cyano-2-methylbenzoic acid, 5-CYANO-2-METHYLBENZOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 0,5g, 100mg, 10g.
5-cyano-2-methylbenzoic acid (CAS 1975-54-8) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 5-cyano-2-methylbenzoic acid. InChIKey: QIKGGLBHJBTYMP-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-cyano-2-methylbenzoic acid |
| InChIKey | QIKGGLBHJBTYMP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)