CAS 1975144-45-6 is the registry number for Methyl (4-iodobenzoyl)-L-threoninate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (2S,3R)-3-hydroxy-2-[(4-iodobenzoyl)amino]butanoate (CAS 1975144-45-6) is a chemical compound with the molecular formula C12H14INO4 and a molecular weight of 363.15 g/mol. IUPAC name: methyl (2S,3R)-3-hydroxy-2-[(4-iodobenzoyl)amino]butanoate. InChIKey: RHQTWLPFTQIZLO-XCBNKYQSSA-N.
| Molecular formula | C12H14INO4 |
|---|---|
| Molecular weight | 363.15 g/mol |
| IUPAC name | methyl (2S,3R)-3-hydroxy-2-[(4-iodobenzoyl)amino]butanoate |
| InChIKey | RHQTWLPFTQIZLO-XCBNKYQSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)C1=CC=C(C=C1)I)O |
Computed by PubChem (NCBI)