Products 2138047-71-7

CAS 2138047-71-7 is the registry number for 2-((tert-Butoxycarbonyl)amino)-4-iodobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 2138047-71-7) is a chemical compound with the molecular formula C12H14INO4 and a molecular weight of 363.15 g/mol. IUPAC name: 4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: TYQRHBWIWRDVER-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14INO4
Molecular weight363.15 g/mol
IUPAC name4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
InChIKeyTYQRHBWIWRDVER-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=CC(=C1)I)C(=O)O

Computed by PubChem (NCBI)