CAS 337973-06-5 is the registry number for 3-{((tert-butoxy)carbonyl)amino}-5-iodobenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 337973-06-5) is a chemical compound with the molecular formula C12H14INO4 and a molecular weight of 363.15 g/mol. IUPAC name: 3-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: QOEAINLHQUJKAU-UHFFFAOYSA-N.
| Molecular formula | C12H14INO4 |
|---|---|
| Molecular weight | 363.15 g/mol |
| IUPAC name | 3-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | QOEAINLHQUJKAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)C(=O)O)I |
Computed by PubChem (NCBI)