Products 1975146-56-5
CAS 1975146-56-5 is the registry number for TC299423. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5E)-5-pyrimidin-5-yl-1,2,3,4,7,8-hexahydroazocine (CAS 1975146-56-5) is a chemical compound with the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. IUPAC name: (5E)-5-pyrimidin-5-yl-1,2,3,4,7,8-hexahydroazocine. InChIKey: CRKXSTOXONBMMP-XCVCLJGOSA-N.
| Molecular formula | C11H15N3 |
|---|---|
| Molecular weight | 189.26 g/mol |
| IUPAC name | (5E)-5-pyrimidin-5-yl-1,2,3,4,7,8-hexahydroazocine |
| InChIKey | CRKXSTOXONBMMP-XCVCLJGOSA-N |
| SMILES | C1C/C(=C\CCNC1)/C2=CN=CN=C2 |
Computed by PubChem (NCBI)