CAS 19759-70-7 is the registry number for Tris(p-isocyanatophenyl)amine. Offered by: TRC. Available pack sizes: 50mg.
4-isocyanato-N,N-bis(4-isocyanatophenyl)aniline (CAS 19759-70-7) is a chemical compound with the molecular formula C21H12N4O3 and a molecular weight of 368.3 g/mol. IUPAC name: 4-isocyanato-N,N-bis(4-isocyanatophenyl)aniline. InChIKey: IIJYXXMUZSBGGR-UHFFFAOYSA-N.
| Molecular formula | C21H12N4O3 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 4-isocyanato-N,N-bis(4-isocyanatophenyl)aniline |
| InChIKey | IIJYXXMUZSBGGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=O)N(C2=CC=C(C=C2)N=C=O)C3=CC=C(C=C3)N=C=O |
Computed by PubChem (NCBI)